C41H26N4 — CID 140822973
9-[3-(2-isocyano-12,12-dimethylindeno[1,2-c]carbazol-5-yl)phenyl]carbazole-3-carbonitrile (PubChem CID 140822973) has the molecular formula C41H26N4 and a molecular weight of 574.69 g/mol. Its IUPAC name is 9-[3-(2-isocyano-12,12-dimethylindeno[1,2-c]carbazol-5-yl)phenyl]carbazole-3-carbonitrile.
| Compound Name | 9-[3-(2-isocyano-12,12-dimethylindeno[1,2-c]carbazol-5-yl)phenyl]carbazole-3-carbonitrile |
|---|---|
| PubChem CID | 140822973 |
| Molecular Formula | C41H26N4 |
| Molecular Weight | 574.69 g/mol |
| Exact Mass | 574.22 |
| IUPAC Name | 9-[3-(2-isocyano-12,12-dimethylindeno[1,2-c]carbazol-5-yl)phenyl]carbazole-3-carbonitrile |
| SMILES | [C-]#[N+]c1ccc2c(c1)c1c3c(ccc1n2-c1cccc(-n2c4ccccc4c4cc(C#N)ccc42)c1)-c1ccccc1C3(C)C |
| InChI | InChI=1S/C41H26N4/c1-41(2)34-13-6-4-11-29(34)31-17-20-38-39(40(31)41)33-22-26(43-3)16-19-37(33)45(38)28-10-8-9-27(23-28)44-35-14-7-5-12-30(35)32-21-25(24-42)15-18-36(32)44/h4-23H,1-2H3 |
| InChIKey | BZALRIFPEPQDKV-UHFFFAOYSA-N |
| XLogP | 10.61 |
| TPSA | 38.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.69 |
| LogP ≤ 5 | 10.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|