C47H28N4O — CID 140822776
9-[8-(12,12-dimethylindeno[2,1-a]carbazol-11-yl)dibenzofuran-2-yl]-6-isocyanocarbazole-3-carbonitrile (PubChem CID 140822776) has the molecular formula C47H28N4O and a molecular weight of 664.77 g/mol. Its IUPAC name is 9-[8-(12,12-dimethylindeno[2,1-a]carbazol-11-yl)dibenzofuran-2-yl]-6-isocyanocarbazole-3-carbonitrile.
| Compound Name | 9-[8-(12,12-dimethylindeno[2,1-a]carbazol-11-yl)dibenzofuran-2-yl]-6-isocyanocarbazole-3-carbonitrile |
|---|---|
| PubChem CID | 140822776 |
| Molecular Formula | C47H28N4O |
| Molecular Weight | 664.77 g/mol |
| Exact Mass | 664.23 |
| IUPAC Name | 9-[8-(12,12-dimethylindeno[2,1-a]carbazol-11-yl)dibenzofuran-2-yl]-6-isocyanocarbazole-3-carbonitrile |
| SMILES | [C-]#[N+]c1ccc2c(c1)c1cc(C#N)ccc1n2-c1ccc2oc3ccc(-n4c5ccccc5c5ccc6c(c54)C(C)(C)c4ccccc4-6)cc3c2c1 |
| InChI | InChI=1S/C47H28N4O/c1-47(2)39-10-6-4-8-31(39)33-16-17-34-32-9-5-7-11-40(32)51(46(34)45(33)47)30-15-21-44-38(25-30)37-24-29(14-20-43(37)52-44)50-41-18-12-27(26-48)22-35(41)36-23-28(49-3)13-19-42(36)50/h4-25H,1-2H3 |
| InChIKey | SVUYAGVOLFBAAB-UHFFFAOYSA-N |
| XLogP | 12.51 |
| TPSA | 51.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 664.77 |
| LogP ≤ 5 | 12.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|