C44H22N4O2 — CID 140822958
9-[8-(2-isocyano-[1]benzofuro[3,2-b]carbazol-11-yl)dibenzofuran-2-yl]carbazole-3-carbonitrile (PubChem CID 140822958) has the molecular formula C44H22N4O2 and a molecular weight of 638.69 g/mol. Its IUPAC name is 9-[8-(2-isocyano-[1]benzofuro[3,2-b]carbazol-11-yl)dibenzofuran-2-yl]carbazole-3-carbonitrile.
| Compound Name | 9-[8-(2-isocyano-[1]benzofuro[3,2-b]carbazol-11-yl)dibenzofuran-2-yl]carbazole-3-carbonitrile |
|---|---|
| PubChem CID | 140822958 |
| Molecular Formula | C44H22N4O2 |
| Molecular Weight | 638.69 g/mol |
| Exact Mass | 638.17 |
| IUPAC Name | 9-[8-(2-isocyano-[1]benzofuro[3,2-b]carbazol-11-yl)dibenzofuran-2-yl]carbazole-3-carbonitrile |
| SMILES | [C-]#[N+]c1ccc2oc3cc4c5ccccc5n(-c5ccc6oc7ccc(-n8c9ccccc9c9cc(C#N)ccc98)cc7c6c5)c4cc3c2c1 |
| InChI | InChI=1S/C44H22N4O2/c1-46-26-11-15-41-33(19-26)36-22-40-32(23-44(36)50-41)30-7-3-5-9-38(30)48(40)28-13-17-43-35(21-28)34-20-27(12-16-42(34)49-43)47-37-8-4-2-6-29(37)31-18-25(24-45)10-14-39(31)47/h2-23H |
| InChIKey | QFTJAWGOLBNLSM-UHFFFAOYSA-N |
| XLogP | 12.10 |
| TPSA | 64.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 638.69 |
| LogP ≤ 5 | 12.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|