C50H27N5O — CID 140850520
9-[6,8-di(carbazol-9-yl)dibenzofuran-2-yl]-6-isocyanocarbazole-3-carbonitrile (PubChem CID 140850520) has the molecular formula C50H27N5O and a molecular weight of 713.80 g/mol. Its IUPAC name is 9-[6,8-di(carbazol-9-yl)dibenzofuran-2-yl]-6-isocyanocarbazole-3-carbonitrile.
| Compound Name | 9-[6,8-di(carbazol-9-yl)dibenzofuran-2-yl]-6-isocyanocarbazole-3-carbonitrile |
|---|---|
| PubChem CID | 140850520 |
| Molecular Formula | C50H27N5O |
| Molecular Weight | 713.80 g/mol |
| Exact Mass | 713.22 |
| IUPAC Name | 9-[6,8-di(carbazol-9-yl)dibenzofuran-2-yl]-6-isocyanocarbazole-3-carbonitrile |
| SMILES | [C-]#[N+]c1ccc2c(c1)c1cc(C#N)ccc1n2-c1ccc2oc3c(-n4c5ccccc5c5ccccc54)cc(-n4c5ccccc5c5ccccc54)cc3c2c1 |
| InChI | InChI=1S/C50H27N5O/c1-52-31-19-22-47-39(25-31)38-24-30(29-51)18-21-46(38)53(47)32-20-23-49-40(26-32)41-27-33(54-42-14-6-2-10-34(42)35-11-3-7-15-43(35)54)28-48(50(41)56-49)55-44-16-8-4-12-36(44)37-13-5-9-17-45(37)55/h2-28H |
| InChIKey | HXEYRMGVLOWGJV-UHFFFAOYSA-N |
| XLogP | 13.30 |
| TPSA | 56.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 713.80 |
| LogP ≤ 5 | 13.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|