C38H20N4S — CID 161466628
9-[6-(3-isocyanocarbazol-9-yl)dibenzothiophen-2-yl]carbazole-3-carbonitrile (PubChem CID 161466628) has the molecular formula C38H20N4S and a molecular weight of 564.67 g/mol. Its IUPAC name is 9-[6-(3-isocyanocarbazol-9-yl)dibenzothiophen-2-yl]carbazole-3-carbonitrile.
| Compound Name | 9-[6-(3-isocyanocarbazol-9-yl)dibenzothiophen-2-yl]carbazole-3-carbonitrile |
|---|---|
| PubChem CID | 161466628 |
| Molecular Formula | C38H20N4S |
| Molecular Weight | 564.67 g/mol |
| Exact Mass | 564.14 |
| IUPAC Name | 9-[6-(3-isocyanocarbazol-9-yl)dibenzothiophen-2-yl]carbazole-3-carbonitrile |
| SMILES | [C-]#[N+]c1ccc2c(c1)c1ccccc1n2-c1cccc2c1sc1ccc(-n3c4ccccc4c4cc(C#N)ccc43)cc12 |
| InChI | InChI=1S/C38H20N4S/c1-40-24-14-17-35-30(20-24)27-8-3-5-11-33(27)42(35)36-12-6-9-28-31-21-25(15-18-37(31)43-38(28)36)41-32-10-4-2-7-26(32)29-19-23(22-39)13-16-34(29)41/h2-21H |
| InChIKey | QITKOLRQUKORLH-UHFFFAOYSA-N |
| XLogP | 10.67 |
| TPSA | 38.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.67 |
| LogP ≤ 5 | 10.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|