C44H24N4S — CID 140822804
9-[3-[3-(9-isocyano-[1]benzothiolo[3,2-c]carbazol-5-yl)phenyl]phenyl]carbazole-3-carbonitrile (PubChem CID 140822804) has the molecular formula C44H24N4S and a molecular weight of 640.77 g/mol. Its IUPAC name is 9-[3-[3-(9-isocyano-[1]benzothiolo[3,2-c]carbazol-5-yl)phenyl]phenyl]carbazole-3-carbonitrile.
| Compound Name | 9-[3-[3-(9-isocyano-[1]benzothiolo[3,2-c]carbazol-5-yl)phenyl]phenyl]carbazole-3-carbonitrile |
|---|---|
| PubChem CID | 140822804 |
| Molecular Formula | C44H24N4S |
| Molecular Weight | 640.77 g/mol |
| Exact Mass | 640.17 |
| IUPAC Name | 9-[3-[3-(9-isocyano-[1]benzothiolo[3,2-c]carbazol-5-yl)phenyl]phenyl]carbazole-3-carbonitrile |
| SMILES | [C-]#[N+]c1ccc2sc3c(ccc4c3c3ccccc3n4-c3cccc(-c4cccc(-n5c6ccccc6c6cc(C#N)ccc65)c4)c3)c2c1 |
| InChI | InChI=1S/C44H24N4S/c1-46-30-17-21-42-37(25-30)34-18-20-41-43(44(34)49-42)35-13-3-5-15-39(35)48(41)32-11-7-9-29(24-32)28-8-6-10-31(23-28)47-38-14-4-2-12-33(38)36-22-27(26-45)16-19-40(36)47/h2-25H |
| InChIKey | PZQZKSXEDUINLH-UHFFFAOYSA-N |
| XLogP | 12.34 |
| TPSA | 38.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 640.77 |
| LogP ≤ 5 | 12.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|