C16H11FN2O — CID 123167762
7-fluoro-2-(1-methylindol-3-yl)-1,3-benzoxazole (PubChem CID 123167762) has the molecular formula C16H11FN2O and a molecular weight of 266.27 g/mol. Its IUPAC name is 7-fluoro-2-(1-methylindol-3-yl)-1,3-benzoxazole.
| Compound Name | 7-fluoro-2-(1-methylindol-3-yl)-1,3-benzoxazole |
|---|---|
| PubChem CID | 123167762 |
| Molecular Formula | C16H11FN2O |
| Molecular Weight | 266.27 g/mol |
| Exact Mass | 266.09 |
| IUPAC Name | 7-fluoro-2-(1-methylindol-3-yl)-1,3-benzoxazole |
| SMILES | Cn1cc(-c2nc3cccc(F)c3o2)c2ccccc21 |
| InChI | InChI=1S/C16H11FN2O/c1-19-9-11(10-5-2-3-8-14(10)19)16-18-13-7-4-6-12(17)15(13)20-16/h2-9H,1H3 |
| InChIKey | IQAHYHSGGUAXFG-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 30.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.27 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |