C12H17BO2 — CID 123167870
1-hydroxy-3,3-dimethyl-6-propan-2-yl-2,1-benzoxaborole (PubChem CID 123167870) has the molecular formula C12H17BO2 and a molecular weight of 204.08 g/mol. Its IUPAC name is 1-hydroxy-3,3-dimethyl-6-propan-2-yl-2,1-benzoxaborole.
| Compound Name | 1-hydroxy-3,3-dimethyl-6-propan-2-yl-2,1-benzoxaborole |
|---|---|
| PubChem CID | 123167870 |
| Molecular Formula | C12H17BO2 |
| Molecular Weight | 204.08 g/mol |
| Exact Mass | 204.13 |
| IUPAC Name | 1-hydroxy-3,3-dimethyl-6-propan-2-yl-2,1-benzoxaborole |
| SMILES | CC(C)c1ccc2c(c1)B(O)OC2(C)C |
| InChI | InChI=1S/C12H17BO2/c1-8(2)9-5-6-10-11(7-9)13(14)15-12(10,3)4/h5-8,14H,1-4H3 |
| InChIKey | YVBJBBFCMADOHD-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.08 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|