C6H19N3Si — CID 123170430
N,N'-diethyl-N"-methylsilylmethanetriamine (PubChem CID 123170430) has the molecular formula C6H19N3Si and a molecular weight of 161.32 g/mol. Its IUPAC name is N,N'-diethyl-N"-methylsilylmethanetriamine.
| Compound Name | N,N'-diethyl-N"-methylsilylmethanetriamine |
|---|---|
| PubChem CID | 123170430 |
| Molecular Formula | C6H19N3Si |
| Molecular Weight | 161.32 g/mol |
| Exact Mass | 161.13 |
| IUPAC Name | N,N'-diethyl-N"-methylsilylmethanetriamine |
| SMILES | CCNC(NCC)N[SiH2]C |
| InChI | InChI=1S/C6H19N3Si/c1-4-7-6(8-5-2)9-10-3/h6-9H,4-5,10H2,1-3H3 |
| InChIKey | LOYUXIRIBJTOMS-UHFFFAOYSA-N |
| XLogP | -0.79 |
| TPSA | 36.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 161.32 |
| LogP ≤ 5 | -0.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|