C17H15F2N3 — CID 123171054
1-[2-(2-fluorophenyl)-2-(4-fluorophenyl)propyl]-1,2,4-triazole (PubChem CID 123171054) has the molecular formula C17H15F2N3 and a molecular weight of 299.32 g/mol. Its IUPAC name is 1-[2-(2-fluorophenyl)-2-(4-fluorophenyl)propyl]-1,2,4-triazole.
| Compound Name | 1-[2-(2-fluorophenyl)-2-(4-fluorophenyl)propyl]-1,2,4-triazole |
|---|---|
| PubChem CID | 123171054 |
| Molecular Formula | C17H15F2N3 |
| Molecular Weight | 299.32 g/mol |
| Exact Mass | 299.12 |
| IUPAC Name | 1-[2-(2-fluorophenyl)-2-(4-fluorophenyl)propyl]-1,2,4-triazole |
| SMILES | CC(Cn1cncn1)(c1ccc(F)cc1)c1ccccc1F |
| InChI | InChI=1S/C17H15F2N3/c1-17(10-22-12-20-11-21-22,13-6-8-14(18)9-7-13)15-4-2-3-5-16(15)19/h2-9,11-12H,10H2,1H3 |
| InChIKey | NTNGSGOAVMMIOR-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.32 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |