C23H16F2N2O — CID 123171521
6-tert-butyl-3,17-difluoro-22-oxa-5,15-diazahexacyclo[17.2.1.02,18.04,16.05,14.08,13]docosa-1,3,6,8,10,12,14,16,18,20-decaene (PubChem CID 123171521) has the molecular formula C23H16F2N2O and a molecular weight of 374.39 g/mol. Its IUPAC name is 6-tert-butyl-3,17-difluoro-22-oxa-5,15-diazahexacyclo[17.2.1.02,18.04,16.05,14.08,13]docosa-1,3,6,8,10,12,14,16,18,20-decaene.
| Compound Name | 6-tert-butyl-3,17-difluoro-22-oxa-5,15-diazahexacyclo[17.2.1.02,18.04,16.05,14.08,13]docosa-1,3,6,8,10,12,14,16,18,20-decaene |
|---|---|
| PubChem CID | 123171521 |
| Molecular Formula | C23H16F2N2O |
| Molecular Weight | 374.39 g/mol |
| Exact Mass | 374.12 |
| IUPAC Name | 6-tert-butyl-3,17-difluoro-22-oxa-5,15-diazahexacyclo[17.2.1.02,18.04,16.05,14.08,13]docosa-1,3,6,8,10,12,14,16,18,20-decaene |
| SMILES | CC(C)(C)c1cc2ccccc2c2nc3c(F)c4c5ccc(o5)c4c(F)c3n12 |
| InChI | InChI=1S/C23H16F2N2O/c1-23(2,3)15-10-11-6-4-5-7-12(11)22-26-20-18(24)16-13-8-9-14(28-13)17(16)19(25)21(20)27(15)22/h4-10H,1-3H3 |
| InChIKey | MWIMSVOATYXJMH-UHFFFAOYSA-N |
| XLogP | 6.55 |
| TPSA | 30.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.39 |
| LogP ≤ 5 | 6.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |