C17H24N2O — CID 123171697
2-amino-N-[4-(cyclodecapentaenyl)butan-2-yl]-N-methylacetamide (PubChem CID 123171697) has the molecular formula C17H24N2O and a molecular weight of 272.39 g/mol. Its IUPAC name is 2-amino-N-[4-(cyclodecapentaenyl)butan-2-yl]-N-methylacetamide.
| Compound Name | 2-amino-N-[4-(cyclodecapentaenyl)butan-2-yl]-N-methylacetamide |
|---|---|
| PubChem CID | 123171697 |
| Molecular Formula | C17H24N2O |
| Molecular Weight | 272.39 g/mol |
| Exact Mass | 272.19 |
| IUPAC Name | 2-amino-N-[4-(cyclodecapentaenyl)butan-2-yl]-N-methylacetamide |
| SMILES | CC(CCc1ccccccccc1)N(C)C(=O)CN |
| InChI | InChI=1S/C17H24N2O/c1-15(19(2)17(20)14-18)12-13-16-10-8-6-4-3-5-7-9-11-16/h3-11,15H,12-14,18H2,1-2H3/b4-3-,5-3-,6-4-,7-5+,8-6+,9-7+,10-8+,11-9-,16-10+,16-11+ |
| InChIKey | GGJJHLBFGMCJFG-ZAGVVYQGSA-N |
| XLogP | 2.55 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.39 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |