C23H28NO2S+ — CID 123172785
5-(4,6-dimethyl-4H-1,3-dioxin-2-yl)-4-ethenyl-4,5-diethylthieno[2,3-a]quinolizin-6-ium (PubChem CID 123172785) has the molecular formula C23H28NO2S+ and a molecular weight of 382.55 g/mol. Its IUPAC name is 5-(4,6-dimethyl-4H-1,3-dioxin-2-yl)-4-ethenyl-4,5-diethylthieno[2,3-a]quinolizin-6-ium.
| Compound Name | 5-(4,6-dimethyl-4H-1,3-dioxin-2-yl)-4-ethenyl-4,5-diethylthieno[2,3-a]quinolizin-6-ium |
|---|---|
| PubChem CID | 123172785 |
| Molecular Formula | C23H28NO2S+ |
| Molecular Weight | 382.55 g/mol |
| Exact Mass | 382.18 |
| IUPAC Name | 5-(4,6-dimethyl-4H-1,3-dioxin-2-yl)-4-ethenyl-4,5-diethylthieno[2,3-a]quinolizin-6-ium |
| SMILES | C=CC1(CC)c2ccsc2-c2cccc[n+]2C1(CC)C1OC(C)=CC(C)O1 |
| InChI | InChI=1S/C23H28NO2S/c1-6-22(7-2)18-12-14-27-20(18)19-11-9-10-13-24(19)23(22,8-3)21-25-16(4)15-17(5)26-21/h6,9-16,21H,1,7-8H2,2-5H3/q+1 |
| InChIKey | VINRTROVUXCOJI-UHFFFAOYSA-N |
| XLogP | 5.32 |
| TPSA | 22.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.55 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|