C31H47N4O4P — CID 123173138
1-[9-(3-bicyclo[3.3.1]nonanyl)-9-azabicyclo[3.3.1]nonan-3-yl]-3-(2-diethoxyphosphorylethylamino)quinoxalin-2-one (PubChem CID 123173138) has the molecular formula C31H47N4O4P and a molecular weight of 570.72 g/mol. Its IUPAC name is 1-[9-(3-bicyclo[3.3.1]nonanyl)-9-azabicyclo[3.3.1]nonan-3-yl]-3-(2-diethoxyphosphorylethylamino)quinoxalin-2-one.
| Compound Name | 1-[9-(3-bicyclo[3.3.1]nonanyl)-9-azabicyclo[3.3.1]nonan-3-yl]-3-(2-diethoxyphosphorylethylamino)quinoxalin-2-one |
|---|---|
| PubChem CID | 123173138 |
| Molecular Formula | C31H47N4O4P |
| Molecular Weight | 570.72 g/mol |
| Exact Mass | 570.33 |
| IUPAC Name | 1-[9-(3-bicyclo[3.3.1]nonanyl)-9-azabicyclo[3.3.1]nonan-3-yl]-3-(2-diethoxyphosphorylethylamino)quinoxalin-2-one |
| SMILES | CCOP(=O)(CCNc1nc2ccccc2n(C2CC3CCCC(C2)N3C2CC3CCCC(C3)C2)c1=O)OCC |
| InChI | InChI=1S/C31H47N4O4P/c1-3-38-40(37,39-4-2)16-15-32-30-31(36)35(29-14-6-5-13-28(29)33-30)27-20-24-11-8-12-25(21-27)34(24)26-18-22-9-7-10-23(17-22)19-26/h5-6,13-14,22-27H,3-4,7-12,15-21H2,1-2H3,(H,32,33) |
| InChIKey | SQXCHTNCWSACLJ-UHFFFAOYSA-N |
| XLogP | 6.60 |
| TPSA | 85.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.72 |
| LogP ≤ 5 | 6.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|