C32H42N4O6 — CID 123924891
methyl 2-(2-acetyloxyethoxyimino)-2-[4-[9-(3-bicyclo[3.3.1]nonanyl)-9-azabicyclo[3.3.1]nonan-3-yl]-3-oxoquinoxalin-2-yl]acetate (PubChem CID 123924891) has the molecular formula C32H42N4O6 and a molecular weight of 578.71 g/mol. Its IUPAC name is methyl 2-(2-acetyloxyethoxyimino)-2-[4-[9-(3-bicyclo[3.3.1]nonanyl)-9-azabicyclo[3.3.1]nonan-3-yl]-3-oxoquinoxalin-2-yl]acetate.
| Compound Name | methyl 2-(2-acetyloxyethoxyimino)-2-[4-[9-(3-bicyclo[3.3.1]nonanyl)-9-azabicyclo[3.3.1]nonan-3-yl]-3-oxoquinoxalin-2-yl]acetate |
|---|---|
| PubChem CID | 123924891 |
| Molecular Formula | C32H42N4O6 |
| Molecular Weight | 578.71 g/mol |
| Exact Mass | 578.31 |
| IUPAC Name | methyl 2-(2-acetyloxyethoxyimino)-2-[4-[9-(3-bicyclo[3.3.1]nonanyl)-9-azabicyclo[3.3.1]nonan-3-yl]-3-oxoquinoxalin-2-yl]acetate |
| SMILES | COC(=O)C(=NOCCOC(C)=O)c1nc2ccccc2n(C2CC3CCCC(C2)N3C2CC3CCCC(C3)C2)c1=O |
| InChI | InChI=1S/C32H42N4O6/c1-20(37)41-13-14-42-34-30(32(39)40-2)29-31(38)36(28-12-4-3-11-27(28)33-29)26-18-23-9-6-10-24(19-26)35(23)25-16-21-7-5-8-22(15-21)17-25/h3-4,11-12,21-26H,5-10,13-19H2,1-2H3 |
| InChIKey | UBSANXNPCXTCNI-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 112.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.71 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|