C31H42N4O4 — CID 90264727
(2Z)-2-[4-[(1R,5S)-9-(8-bicyclo[4.3.1]decanyl)-9-azabicyclo[3.3.1]nonan-3-yl]-3-oxoquinoxalin-2-yl]-2-propan-2-yloxyiminoacetic acid (PubChem CID 90264727) has the molecular formula C31H42N4O4 and a molecular weight of 534.70 g/mol. Its IUPAC name is (2Z)-2-[4-[(1R,5S)-9-(8-bicyclo[4.3.1]decanyl)-9-azabicyclo[3.3.1]nonan-3-yl]-3-oxoquinoxalin-2-yl]-2-propan-2-yloxyiminoacetic acid.
| Compound Name | (2Z)-2-[4-[(1R,5S)-9-(8-bicyclo[4.3.1]decanyl)-9-azabicyclo[3.3.1]nonan-3-yl]-3-oxoquinoxalin-2-yl]-2-propan-2-yloxyiminoacetic acid |
|---|---|
| PubChem CID | 90264727 |
| Molecular Formula | C31H42N4O4 |
| Molecular Weight | 534.70 g/mol |
| Exact Mass | 534.32 |
| IUPAC Name | (2Z)-2-[4-[(1R,5S)-9-(8-bicyclo[4.3.1]decanyl)-9-azabicyclo[3.3.1]nonan-3-yl]-3-oxoquinoxalin-2-yl]-2-propan-2-yloxyiminoacetic acid |
| SMILES | CC(C)O/N=C(\C(=O)O)c1nc2ccccc2n(C2C[C@H]3CCC[C@@H](C2)N3C2CC3CCCCC(C3)C2)c1=O |
| InChI | InChI=1S/C31H42N4O4/c1-19(2)39-33-29(31(37)38)28-30(36)35(27-13-6-5-12-26(27)32-28)25-17-22-10-7-11-23(18-25)34(22)24-15-20-8-3-4-9-21(14-20)16-24/h5-6,12-13,19-25H,3-4,7-11,14-18H2,1-2H3,(H,37,38)/b33-29-/t20?,21?,22-,23+,24?,25? |
| InChIKey | DMLZWCPURMZLRO-IJPFFDHISA-N |
| XLogP | 5.53 |
| TPSA | 97.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.70 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|