C28H36N4O4 — CID 90264605
(2Z)-2-[4-[(1R,5S)-8-[(1S,6R)-8-bicyclo[4.3.1]decanyl]-8-azabicyclo[3.2.1]octan-3-yl]-3-oxoquinoxalin-2-yl]-2-methoxyiminoacetic acid (PubChem CID 90264605) has the molecular formula C28H36N4O4 and a molecular weight of 492.62 g/mol. Its IUPAC name is (2Z)-2-[4-[(1R,5S)-8-[(1S,6R)-8-bicyclo[4.3.1]decanyl]-8-azabicyclo[3.2.1]octan-3-yl]-3-oxoquinoxalin-2-yl]-2-methoxyiminoacetic acid.
| Compound Name | (2Z)-2-[4-[(1R,5S)-8-[(1S,6R)-8-bicyclo[4.3.1]decanyl]-8-azabicyclo[3.2.1]octan-3-yl]-3-oxoquinoxalin-2-yl]-2-methoxyiminoacetic acid |
|---|---|
| PubChem CID | 90264605 |
| Molecular Formula | C28H36N4O4 |
| Molecular Weight | 492.62 g/mol |
| Exact Mass | 492.27 |
| IUPAC Name | (2Z)-2-[4-[(1R,5S)-8-[(1S,6R)-8-bicyclo[4.3.1]decanyl]-8-azabicyclo[3.2.1]octan-3-yl]-3-oxoquinoxalin-2-yl]-2-methoxyiminoacetic acid |
| SMILES | CO/N=C(\C(=O)O)c1nc2ccccc2n(C2C[C@H]3CC[C@@H](C2)N3C2C[C@H]3CCCC[C@@H](C2)C3)c1=O |
| InChI | InChI=1S/C28H36N4O4/c1-36-30-26(28(34)35)25-27(33)32(24-9-5-4-8-23(24)29-25)22-15-19-10-11-20(16-22)31(19)21-13-17-6-2-3-7-18(12-17)14-21/h4-5,8-9,17-22H,2-3,6-7,10-16H2,1H3,(H,34,35)/b30-26-/t17-,18+,19-,20+,21?,22? |
| InChIKey | WBNHJVQBZJTVOU-GKIVJSLYSA-N |
| XLogP | 4.36 |
| TPSA | 97.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.62 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|