C29H37N5O5 — CID 123610139
2-(2-amino-2-oxoethoxy)imino-2-[4-[8-(8-bicyclo[4.3.1]decanyl)-8-azabicyclo[3.2.1]octan-3-yl]-3-oxoquinoxalin-2-yl]acetic acid (PubChem CID 123610139) has the molecular formula C29H37N5O5 and a molecular weight of 535.65 g/mol. Its IUPAC name is 2-(2-amino-2-oxoethoxy)imino-2-[4-[8-(8-bicyclo[4.3.1]decanyl)-8-azabicyclo[3.2.1]octan-3-yl]-3-oxoquinoxalin-2-yl]acetic acid.
| Compound Name | 2-(2-amino-2-oxoethoxy)imino-2-[4-[8-(8-bicyclo[4.3.1]decanyl)-8-azabicyclo[3.2.1]octan-3-yl]-3-oxoquinoxalin-2-yl]acetic acid |
|---|---|
| PubChem CID | 123610139 |
| Molecular Formula | C29H37N5O5 |
| Molecular Weight | 535.65 g/mol |
| Exact Mass | 535.28 |
| IUPAC Name | 2-(2-amino-2-oxoethoxy)imino-2-[4-[8-(8-bicyclo[4.3.1]decanyl)-8-azabicyclo[3.2.1]octan-3-yl]-3-oxoquinoxalin-2-yl]acetic acid |
| SMILES | NC(=O)CON=C(C(=O)O)c1nc2ccccc2n(C2CC3CCC(C2)N3C2CC3CCCCC(C3)C2)c1=O |
| InChI | InChI=1S/C29H37N5O5/c30-25(35)16-39-32-27(29(37)38)26-28(36)34(24-8-4-3-7-23(24)31-26)22-14-19-9-10-20(15-22)33(19)21-12-17-5-1-2-6-18(11-17)13-21/h3-4,7-8,17-22H,1-2,5-6,9-16H2,(H2,30,35)(H,37,38) |
| InChIKey | GYFMNONREYGJBF-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 140.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.65 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|