C29H38N4O4 — CID 123153333
2-[1-[4-[(1R,5S)-8-[(1S,6R)-8-bicyclo[4.3.1]decanyl]-8-azabicyclo[3.2.1]octan-3-yl]-3-oxoquinoxalin-2-yl]ethylideneamino]oxyacetic acid (PubChem CID 123153333) has the molecular formula C29H38N4O4 and a molecular weight of 506.65 g/mol. Its IUPAC name is 2-[1-[4-[(1R,5S)-8-[(1S,6R)-8-bicyclo[4.3.1]decanyl]-8-azabicyclo[3.2.1]octan-3-yl]-3-oxoquinoxalin-2-yl]ethylideneamino]oxyacetic acid.
| Compound Name | 2-[1-[4-[(1R,5S)-8-[(1S,6R)-8-bicyclo[4.3.1]decanyl]-8-azabicyclo[3.2.1]octan-3-yl]-3-oxoquinoxalin-2-yl]ethylideneamino]oxyacetic acid |
|---|---|
| PubChem CID | 123153333 |
| Molecular Formula | C29H38N4O4 |
| Molecular Weight | 506.65 g/mol |
| Exact Mass | 506.29 |
| IUPAC Name | 2-[1-[4-[(1R,5S)-8-[(1S,6R)-8-bicyclo[4.3.1]decanyl]-8-azabicyclo[3.2.1]octan-3-yl]-3-oxoquinoxalin-2-yl]ethylideneamino]oxyacetic acid |
| SMILES | CC(=NOCC(=O)O)c1nc2ccccc2n(C2C[C@H]3CC[C@@H](C2)N3C2C[C@H]3CCCC[C@@H](C2)C3)c1=O |
| InChI | InChI=1S/C29H38N4O4/c1-18(31-37-17-27(34)35)28-29(36)33(26-9-5-4-8-25(26)30-28)24-15-21-10-11-22(16-24)32(21)23-13-19-6-2-3-7-20(12-19)14-23/h4-5,8-9,19-24H,2-3,6-7,10-17H2,1H3,(H,34,35)/t19-,20+,21-,22+,23?,24? |
| InChIKey | AVSZRYVECVXJEC-QVGYUHCVSA-N |
| XLogP | 4.75 |
| TPSA | 97.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.65 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|