C8H7NO2 — CID 123173377
3,7-dihydro-2H-indole-5,6-dione (PubChem CID 123173377) has the molecular formula C8H7NO2 and a molecular weight of 149.15 g/mol. Its IUPAC name is 3,7-dihydro-2H-indole-5,6-dione.
| Compound Name | 3,7-dihydro-2H-indole-5,6-dione |
|---|---|
| PubChem CID | 123173377 |
| Molecular Formula | C8H7NO2 |
| Molecular Weight | 149.15 g/mol |
| Exact Mass | 149.05 |
| IUPAC Name | 3,7-dihydro-2H-indole-5,6-dione |
| SMILES | O=C1C=C2CCN=C2CC1=O |
| InChI | InChI=1S/C8H7NO2/c10-7-3-5-1-2-9-6(5)4-8(7)11/h3H,1-2,4H2 |
| InChIKey | MDINNLSHINNOCP-UHFFFAOYSA-N |
| XLogP | 0.30 |
| TPSA | 46.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 149.15 |
| LogP ≤ 5 | 0.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|