C11H15NO — CID 123763156
6-(cyclohexen-1-yl)-4,5-dihydro-2H-pyridin-3-one (PubChem CID 123763156) has the molecular formula C11H15NO and a molecular weight of 177.25 g/mol. Its IUPAC name is 6-(cyclohexen-1-yl)-4,5-dihydro-2H-pyridin-3-one.
| Compound Name | 6-(cyclohexen-1-yl)-4,5-dihydro-2H-pyridin-3-one |
|---|---|
| PubChem CID | 123763156 |
| Molecular Formula | C11H15NO |
| Molecular Weight | 177.25 g/mol |
| Exact Mass | 177.12 |
| IUPAC Name | 6-(cyclohexen-1-yl)-4,5-dihydro-2H-pyridin-3-one |
| SMILES | O=C1CCC(C2=CCCCC2)=NC1 |
| InChI | InChI=1S/C11H15NO/c13-10-6-7-11(12-8-10)9-4-2-1-3-5-9/h4H,1-3,5-8H2 |
| InChIKey | SHRIURBBEFAOOB-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 29.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 177.25 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |