C11H18 — CID 123174186
5,7,8-trimethyltricyclo[3.2.1.01,4]octane (PubChem CID 123174186) has the molecular formula C11H18 and a molecular weight of 150.27 g/mol. Its IUPAC name is 5,7,8-trimethyltricyclo[3.2.1.01,4]octane.
| Compound Name | 5,7,8-trimethyltricyclo[3.2.1.01,4]octane |
|---|---|
| PubChem CID | 123174186 |
| Molecular Formula | C11H18 |
| Molecular Weight | 150.27 g/mol |
| Exact Mass | 150.14 |
| IUPAC Name | 5,7,8-trimethyltricyclo[3.2.1.01,4]octane |
| SMILES | CC1CC2(C)C(C)C13CCC23 |
| InChI | InChI=1S/C11H18/c1-7-6-10(3)8(2)11(7)5-4-9(10)11/h7-9H,4-6H2,1-3H3 |
| InChIKey | WVGCRUUVVYPFOJ-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 150.27 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |