C20H32O3 — CID 162976820
(1S,4S,7R,9R,10S,13S,15S,16R)-5,5,9-trimethyl-14-methylidenetetracyclo[11.2.1.01,10.04,9]hexadecane-7,15,16-triol (PubChem CID 162976820) has the molecular formula C20H32O3 and a molecular weight of 320.47 g/mol. Its IUPAC name is (1S,4S,7R,9R,10S,13S,15S,16R)-5,5,9-trimethyl-14-methylidenetetracyclo[11.2.1.01,10.04,9]hexadecane-7,15,16-triol.
| Compound Name | (1S,4S,7R,9R,10S,13S,15S,16R)-5,5,9-trimethyl-14-methylidenetetracyclo[11.2.1.01,10.04,9]hexadecane-7,15,16-triol |
|---|---|
| PubChem CID | 162976820 |
| Molecular Formula | C20H32O3 |
| Molecular Weight | 320.47 g/mol |
| Exact Mass | 320.24 |
| IUPAC Name | (1S,4S,7R,9R,10S,13S,15S,16R)-5,5,9-trimethyl-14-methylidenetetracyclo[11.2.1.01,10.04,9]hexadecane-7,15,16-triol |
| SMILES | C=C1[C@@H]2CC[C@H]3[C@]4(C)C[C@H](O)CC(C)(C)[C@@H]4CC[C@]3([C@@H]2O)[C@H]1O |
| InChI | InChI=1S/C20H32O3/c1-11-13-5-6-15-19(4)10-12(21)9-18(2,3)14(19)7-8-20(15,16(11)22)17(13)23/h12-17,21-23H,1,5-10H2,2-4H3/t12-,13+,14+,15+,16+,17-,19-,20-/m1/s1 |
| InChIKey | ZAKITPKIZFTDJV-OVBDAQPSSA-N |
| XLogP | 2.89 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.47 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|