C30H23F6N5O2 — CID 123175045
5-[2-[2-(3,5-difluorophenyl)-1-[[2-[7-(trifluoromethyl)-8,9-diazatricyclo[4.3.0.02,4]nona-1(6),7-dien-9-yl]acetyl]amino]ethyl]-3-pyridinyl]-2-fluorobenzamide (PubChem CID 123175045) has the molecular formula C30H23F6N5O2 and a molecular weight of 599.54 g/mol. Its IUPAC name is 5-[2-[2-(3,5-difluorophenyl)-1-[[2-[7-(trifluoromethyl)-8,9-diazatricyclo[4.3.0.02,4]nona-1(6),7-dien-9-yl]acetyl]amino]ethyl]-3-pyridinyl]-2-fluorobenzamide.
| Compound Name | 5-[2-[2-(3,5-difluorophenyl)-1-[[2-[7-(trifluoromethyl)-8,9-diazatricyclo[4.3.0.02,4]nona-1(6),7-dien-9-yl]acetyl]amino]ethyl]-3-pyridinyl]-2-fluorobenzamide |
|---|---|
| PubChem CID | 123175045 |
| Molecular Formula | C30H23F6N5O2 |
| Molecular Weight | 599.54 g/mol |
| Exact Mass | 599.18 |
| IUPAC Name | 5-[2-[2-(3,5-difluorophenyl)-1-[[2-[7-(trifluoromethyl)-8,9-diazatricyclo[4.3.0.02,4]nona-1(6),7-dien-9-yl]acetyl]amino]ethyl]-3-pyridinyl]-2-fluorobenzamide |
| SMILES | NC(=O)c1cc(-c2cccnc2C(Cc2cc(F)cc(F)c2)NC(=O)Cn2nc(C(F)(F)F)c3c2C2CC2C3)ccc1F |
| InChI | InChI=1S/C30H23F6N5O2/c31-17-6-14(7-18(32)12-17)8-24(26-19(2-1-5-38-26)15-3-4-23(33)21(9-15)29(37)43)39-25(42)13-41-27-20-10-16(20)11-22(27)28(40-41)30(34,35)36/h1-7,9,12,16,20,24H,8,10-11,13H2,(H2,37,43)(H,39,42) |
| InChIKey | TYXYTSNFIZETAF-UHFFFAOYSA-N |
| XLogP | 5.24 |
| TPSA | 102.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 599.54 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |