C30H25F6N5O3 — CID 86719843
5-[2-[(1S)-2-(3,5-difluorophenyl)-1-[[2-[6-hydroxy-3-(trifluoromethyl)-4,5,6,7-tetrahydroindazol-1-yl]acetyl]amino]ethyl]-3-pyridinyl]-2-fluorobenzamide (PubChem CID 86719843) has the molecular formula C30H25F6N5O3 and a molecular weight of 617.55 g/mol. Its IUPAC name is 5-[2-[(1S)-2-(3,5-difluorophenyl)-1-[[2-[6-hydroxy-3-(trifluoromethyl)-4,5,6,7-tetrahydroindazol-1-yl]acetyl]amino]ethyl]-3-pyridinyl]-2-fluorobenzamide.
| Compound Name | 5-[2-[(1S)-2-(3,5-difluorophenyl)-1-[[2-[6-hydroxy-3-(trifluoromethyl)-4,5,6,7-tetrahydroindazol-1-yl]acetyl]amino]ethyl]-3-pyridinyl]-2-fluorobenzamide |
|---|---|
| PubChem CID | 86719843 |
| Molecular Formula | C30H25F6N5O3 |
| Molecular Weight | 617.55 g/mol |
| Exact Mass | 617.19 |
| IUPAC Name | 5-[2-[(1S)-2-(3,5-difluorophenyl)-1-[[2-[6-hydroxy-3-(trifluoromethyl)-4,5,6,7-tetrahydroindazol-1-yl]acetyl]amino]ethyl]-3-pyridinyl]-2-fluorobenzamide |
| SMILES | NC(=O)c1cc(-c2cccnc2[C@H](Cc2cc(F)cc(F)c2)NC(=O)Cn2nc(C(F)(F)F)c3c2CC(O)CC3)ccc1F |
| InChI | InChI=1S/C30H25F6N5O3/c31-17-8-15(9-18(32)12-17)10-24(27-20(2-1-7-38-27)16-3-6-23(33)22(11-16)29(37)44)39-26(43)14-41-25-13-19(42)4-5-21(25)28(40-41)30(34,35)36/h1-3,6-9,11-12,19,24,42H,4-5,10,13-14H2,(H2,37,44)(H,39,43)/t19?,24-/m0/s1 |
| InChIKey | UPSIADHGNSFFGO-WIIYFNMSSA-N |
| XLogP | 4.43 |
| TPSA | 123.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 617.55 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |