C16H15Br2N3 — CID 123176475
3-(2,7-dibromocarbazol-9-yl)-N'-methylpropanimidamide (PubChem CID 123176475) has the molecular formula C16H15Br2N3 and a molecular weight of 409.13 g/mol. Its IUPAC name is 3-(2,7-dibromocarbazol-9-yl)-N'-methylpropanimidamide.
| Compound Name | 3-(2,7-dibromocarbazol-9-yl)-N'-methylpropanimidamide |
|---|---|
| PubChem CID | 123176475 |
| Molecular Formula | C16H15Br2N3 |
| Molecular Weight | 409.13 g/mol |
| Exact Mass | 406.96 |
| IUPAC Name | 3-(2,7-dibromocarbazol-9-yl)-N'-methylpropanimidamide |
| SMILES | C/N=C(\N)CCn1c2cc(Br)ccc2c2ccc(Br)cc21 |
| InChI | InChI=1S/C16H15Br2N3/c1-20-16(19)6-7-21-14-8-10(17)2-4-12(14)13-5-3-11(18)9-15(13)21/h2-5,8-9H,6-7H2,1H3,(H2,19,20) |
| InChIKey | RCUDABLUBGZUNS-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 43.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.13 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|