C19H20Br2N2O — CID 144652940
4-[2-(2,7-dibromocarbazol-9-yl)ethyl-methylamino]butanal (PubChem CID 144652940) has the molecular formula C19H20Br2N2O and a molecular weight of 452.19 g/mol. Its IUPAC name is 4-[2-(2,7-dibromocarbazol-9-yl)ethyl-methylamino]butanal.
| Compound Name | 4-[2-(2,7-dibromocarbazol-9-yl)ethyl-methylamino]butanal |
|---|---|
| PubChem CID | 144652940 |
| Molecular Formula | C19H20Br2N2O |
| Molecular Weight | 452.19 g/mol |
| Exact Mass | 449.99 |
| IUPAC Name | 4-[2-(2,7-dibromocarbazol-9-yl)ethyl-methylamino]butanal |
| SMILES | CN(CCCC=O)CCn1c2cc(Br)ccc2c2ccc(Br)cc21 |
| InChI | InChI=1S/C19H20Br2N2O/c1-22(8-2-3-11-24)9-10-23-18-12-14(20)4-6-16(18)17-7-5-15(21)13-19(17)23/h4-7,11-13H,2-3,8-10H2,1H3 |
| InChIKey | OZUAJRMSCMPSAO-UHFFFAOYSA-N |
| XLogP | 5.23 |
| TPSA | 25.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.19 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|