C36H56N2O8 — CID 123176729
2-[2-[2-[4-(1-adamantylmethylamino)-4-oxobutanoyl]oxyethoxy]ethoxy]ethyl 4-(1-adamantylmethylamino)-4-oxobutanoate (PubChem CID 123176729) has the molecular formula C36H56N2O8 and a molecular weight of 644.85 g/mol. Its IUPAC name is 2-[2-[2-[4-(1-adamantylmethylamino)-4-oxobutanoyl]oxyethoxy]ethoxy]ethyl 4-(1-adamantylmethylamino)-4-oxobutanoate.
| Compound Name | 2-[2-[2-[4-(1-adamantylmethylamino)-4-oxobutanoyl]oxyethoxy]ethoxy]ethyl 4-(1-adamantylmethylamino)-4-oxobutanoate |
|---|---|
| PubChem CID | 123176729 |
| Molecular Formula | C36H56N2O8 |
| Molecular Weight | 644.85 g/mol |
| Exact Mass | 644.40 |
| IUPAC Name | 2-[2-[2-[4-(1-adamantylmethylamino)-4-oxobutanoyl]oxyethoxy]ethoxy]ethyl 4-(1-adamantylmethylamino)-4-oxobutanoate |
| SMILES | O=C(CCC(=O)OCCOCCOCCOC(=O)CCC(=O)NCC12CC3CC(CC(C3)C1)C2)NCC12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C36H56N2O8/c39-31(37-23-35-17-25-11-26(18-35)13-27(12-25)19-35)1-3-33(41)45-9-7-43-5-6-44-8-10-46-34(42)4-2-32(40)38-24-36-20-28-14-29(21-36)16-30(15-28)22-36/h25-30H,1-24H2,(H,37,39)(H,38,40) |
| InChIKey | LRNBZORQIPCJCH-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 129.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 46 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 644.85 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|