C31H49NOSi — CID 123176914
12-[tert-butyl(diphenyl)silyl]oxy-N-propan-2-yldodec-5-en-1-amine (PubChem CID 123176914) has the molecular formula C31H49NOSi and a molecular weight of 479.83 g/mol. Its IUPAC name is 12-[tert-butyl(diphenyl)silyl]oxy-N-propan-2-yldodec-5-en-1-amine.
| Compound Name | 12-[tert-butyl(diphenyl)silyl]oxy-N-propan-2-yldodec-5-en-1-amine |
|---|---|
| PubChem CID | 123176914 |
| Molecular Formula | C31H49NOSi |
| Molecular Weight | 479.83 g/mol |
| Exact Mass | 479.36 |
| IUPAC Name | 12-[tert-butyl(diphenyl)silyl]oxy-N-propan-2-yldodec-5-en-1-amine |
| SMILES | CC(C)NCCCCC=CCCCCCCO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C31H49NOSi/c1-28(2)32-26-20-12-10-8-6-7-9-11-13-21-27-33-34(31(3,4)5,29-22-16-14-17-23-29)30-24-18-15-19-25-30/h6,8,14-19,22-25,28,32H,7,9-13,20-21,26-27H2,1-5H3 |
| InChIKey | BUIQVRPSZYLOKN-UHFFFAOYSA-N |
| XLogP | 7.24 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.83 |
| LogP ≤ 5 | 7.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|