C38H31NSSi — CID 123177063
N-[4-(10,10-dimethylbenzo[b][1,4]benzothiasilin-2-yl)phenyl]-N,4-diphenylaniline (PubChem CID 123177063) has the molecular formula C38H31NSSi and a molecular weight of 561.83 g/mol. Its IUPAC name is N-[4-(10,10-dimethylbenzo[b][1,4]benzothiasilin-2-yl)phenyl]-N,4-diphenylaniline.
| Compound Name | N-[4-(10,10-dimethylbenzo[b][1,4]benzothiasilin-2-yl)phenyl]-N,4-diphenylaniline |
|---|---|
| PubChem CID | 123177063 |
| Molecular Formula | C38H31NSSi |
| Molecular Weight | 561.83 g/mol |
| Exact Mass | 561.19 |
| IUPAC Name | N-[4-(10,10-dimethylbenzo[b][1,4]benzothiasilin-2-yl)phenyl]-N,4-diphenylaniline |
| SMILES | C[Si]1(C)c2ccccc2Sc2ccc(-c3ccc(N(c4ccccc4)c4ccc(-c5ccccc5)cc4)cc3)cc21 |
| InChI | InChI=1S/C38H31NSSi/c1-41(2)37-16-10-9-15-35(37)40-36-26-21-31(27-38(36)41)30-19-24-34(25-20-30)39(32-13-7-4-8-14-32)33-22-17-29(18-23-33)28-11-5-3-6-12-28/h3-27H,1-2H3 |
| InChIKey | CTFRPIHHNFJMTF-UHFFFAOYSA-N |
| XLogP | 9.78 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.83 |
| LogP ≤ 5 | 9.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|