C50H39NOSi — CID 123808366
N-[4-(10,10-dimethylbenzo[b][1,4]benzoxasilin-2-yl)phenyl]-4-phenyl-N-[4-(3-phenylphenyl)phenyl]aniline (PubChem CID 123808366) has the molecular formula C50H39NOSi and a molecular weight of 697.95 g/mol. Its IUPAC name is N-[4-(10,10-dimethylbenzo[b][1,4]benzoxasilin-2-yl)phenyl]-4-phenyl-N-[4-(3-phenylphenyl)phenyl]aniline.
| Compound Name | N-[4-(10,10-dimethylbenzo[b][1,4]benzoxasilin-2-yl)phenyl]-4-phenyl-N-[4-(3-phenylphenyl)phenyl]aniline |
|---|---|
| PubChem CID | 123808366 |
| Molecular Formula | C50H39NOSi |
| Molecular Weight | 697.95 g/mol |
| Exact Mass | 697.28 |
| IUPAC Name | N-[4-(10,10-dimethylbenzo[b][1,4]benzoxasilin-2-yl)phenyl]-4-phenyl-N-[4-(3-phenylphenyl)phenyl]aniline |
| SMILES | C[Si]1(C)c2ccccc2Oc2ccc(-c3ccc(N(c4ccc(-c5ccccc5)cc4)c4ccc(-c5cccc(-c6ccccc6)c5)cc4)cc3)cc21 |
| InChI | InChI=1S/C50H39NOSi/c1-53(2)49-19-10-9-18-47(49)52-48-33-26-43(35-50(48)53)40-24-31-46(32-25-40)51(44-27-20-38(21-28-44)36-12-5-3-6-13-36)45-29-22-39(23-30-45)42-17-11-16-41(34-42)37-14-7-4-8-15-37/h3-35H,1-2H3 |
| InChIKey | BXNKNSXZDZVBEU-UHFFFAOYSA-N |
| XLogP | 12.75 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 697.95 |
| LogP ≤ 5 | 12.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|