C49H38N2Si — CID 140711993
N-[4-[3-(9,9-dimethyl-[1]benzosilolo[2,3-c]pyridin-7-yl)phenyl]phenyl]-4-phenyl-N-(4-phenylphenyl)aniline (PubChem CID 140711993) has the molecular formula C49H38N2Si and a molecular weight of 682.94 g/mol. Its IUPAC name is N-[4-[3-(9,9-dimethyl-[1]benzosilolo[2,3-c]pyridin-7-yl)phenyl]phenyl]-4-phenyl-N-(4-phenylphenyl)aniline.
| Compound Name | N-[4-[3-(9,9-dimethyl-[1]benzosilolo[2,3-c]pyridin-7-yl)phenyl]phenyl]-4-phenyl-N-(4-phenylphenyl)aniline |
|---|---|
| PubChem CID | 140711993 |
| Molecular Formula | C49H38N2Si |
| Molecular Weight | 682.94 g/mol |
| Exact Mass | 682.28 |
| IUPAC Name | N-[4-[3-(9,9-dimethyl-[1]benzosilolo[2,3-c]pyridin-7-yl)phenyl]phenyl]-4-phenyl-N-(4-phenylphenyl)aniline |
| SMILES | C[Si]1(C)c2cnccc2-c2ccc(-c3cccc(-c4ccc(N(c5ccc(-c6ccccc6)cc5)c5ccc(-c6ccccc6)cc5)cc4)c3)cc21 |
| InChI | InChI=1S/C49H38N2Si/c1-52(2)48-33-42(22-29-46(48)47-30-31-50-34-49(47)52)41-15-9-14-40(32-41)39-20-27-45(28-21-39)51(43-23-16-37(17-24-43)35-10-5-3-6-11-35)44-25-18-38(19-26-44)36-12-7-4-8-13-36/h3-34H,1-2H3 |
| InChIKey | NVKZCOHAUYFIIO-UHFFFAOYSA-N |
| XLogP | 12.02 |
| TPSA | 16.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 682.94 |
| LogP ≤ 5 | 12.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|