C22H18N5O5S+ — CID 123178589
N-cyclopropyl-1-[3-(1-hydroxypyridin-1-ium-3-yl)sulfonylphenyl]-4-oxopyrido[2,3-c]pyridazine-3-carboxamide (PubChem CID 123178589) has the molecular formula C22H18N5O5S+ and a molecular weight of 464.48 g/mol. Its IUPAC name is N-cyclopropyl-1-[3-(1-hydroxypyridin-1-ium-3-yl)sulfonylphenyl]-4-oxopyrido[2,3-c]pyridazine-3-carboxamide.
| Compound Name | N-cyclopropyl-1-[3-(1-hydroxypyridin-1-ium-3-yl)sulfonylphenyl]-4-oxopyrido[2,3-c]pyridazine-3-carboxamide |
|---|---|
| PubChem CID | 123178589 |
| Molecular Formula | C22H18N5O5S+ |
| Molecular Weight | 464.48 g/mol |
| Exact Mass | 464.10 |
| IUPAC Name | N-cyclopropyl-1-[3-(1-hydroxypyridin-1-ium-3-yl)sulfonylphenyl]-4-oxopyrido[2,3-c]pyridazine-3-carboxamide |
| SMILES | O=C(NC1CC1)c1nn(-c2cccc(S(=O)(=O)c3ccc[n+](O)c3)c2)c2ncccc2c1=O |
| InChI | InChI=1S/C22H17N5O5S/c28-20-18-7-2-10-23-21(18)27(25-19(20)22(29)24-14-8-9-14)15-4-1-5-16(12-15)33(31,32)17-6-3-11-26(30)13-17/h1-7,10-14H,8-9H2,(H-,24,29,30)/p+1 |
| InChIKey | YTLQLRQKSXRHFV-UHFFFAOYSA-O |
| XLogP | 1.03 |
| TPSA | 135.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.48 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'N-hydroxyl_pyridine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|