C8H11N3 — CID 123179193
2-(3-methylidenecyclohexa-1,5-dien-1-yl)guanidine (PubChem CID 123179193) has the molecular formula C8H11N3 and a molecular weight of 149.20 g/mol. Its IUPAC name is 2-(3-methylidenecyclohexa-1,5-dien-1-yl)guanidine.
| Compound Name | 2-(3-methylidenecyclohexa-1,5-dien-1-yl)guanidine |
|---|---|
| PubChem CID | 123179193 |
| Molecular Formula | C8H11N3 |
| Molecular Weight | 149.20 g/mol |
| Exact Mass | 149.10 |
| IUPAC Name | 2-(3-methylidenecyclohexa-1,5-dien-1-yl)guanidine |
| SMILES | C=C1C=C(N=C(N)N)C=CC1 |
| InChI | InChI=1S/C8H11N3/c1-6-3-2-4-7(5-6)11-8(9)10/h2,4-5H,1,3H2,(H4,9,10,11) |
| InChIKey | OOYXWEKDRHLGPX-UHFFFAOYSA-N |
| XLogP | 0.66 |
| TPSA | 64.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 149.20 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|