C20H25FN2O5S — CID 123179289
3-fluoro-N-[(2R)-2-hydroxy-4-phenylbutyl]-N-(2-methylpropyl)-4-nitrobenzenesulfonamide (PubChem CID 123179289) has the molecular formula C20H25FN2O5S and a molecular weight of 424.49 g/mol. Its IUPAC name is 3-fluoro-N-[(2R)-2-hydroxy-4-phenylbutyl]-N-(2-methylpropyl)-4-nitrobenzenesulfonamide.
| Compound Name | 3-fluoro-N-[(2R)-2-hydroxy-4-phenylbutyl]-N-(2-methylpropyl)-4-nitrobenzenesulfonamide |
|---|---|
| PubChem CID | 123179289 |
| Molecular Formula | C20H25FN2O5S |
| Molecular Weight | 424.49 g/mol |
| Exact Mass | 424.15 |
| IUPAC Name | 3-fluoro-N-[(2R)-2-hydroxy-4-phenylbutyl]-N-(2-methylpropyl)-4-nitrobenzenesulfonamide |
| SMILES | CC(C)CN(C[C@H](O)CCc1ccccc1)S(=O)(=O)c1ccc([N+](=O)[O-])c(F)c1 |
| InChI | InChI=1S/C20H25FN2O5S/c1-15(2)13-22(14-17(24)9-8-16-6-4-3-5-7-16)29(27,28)18-10-11-20(23(25)26)19(21)12-18/h3-7,10-12,15,17,24H,8-9,13-14H2,1-2H3/t17-/m1/s1 |
| InChIKey | KQDICEVIKOEHNC-QGZVFWFLSA-N |
| XLogP | 3.37 |
| TPSA | 100.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.49 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|