C12H14FN3O4 — CID 123181253
4-amino-1-(4-fluoro-5,6-dihydroxy-1-prop-1-en-2-yl-2-oxabicyclo[3.1.0]hexan-3-yl)pyrimidin-2-one (PubChem CID 123181253) has the molecular formula C12H14FN3O4 and a molecular weight of 283.26 g/mol. Its IUPAC name is 4-amino-1-(4-fluoro-5,6-dihydroxy-1-prop-1-en-2-yl-2-oxabicyclo[3.1.0]hexan-3-yl)pyrimidin-2-one.
| Compound Name | 4-amino-1-(4-fluoro-5,6-dihydroxy-1-prop-1-en-2-yl-2-oxabicyclo[3.1.0]hexan-3-yl)pyrimidin-2-one |
|---|---|
| PubChem CID | 123181253 |
| Molecular Formula | C12H14FN3O4 |
| Molecular Weight | 283.26 g/mol |
| Exact Mass | 283.10 |
| IUPAC Name | 4-amino-1-(4-fluoro-5,6-dihydroxy-1-prop-1-en-2-yl-2-oxabicyclo[3.1.0]hexan-3-yl)pyrimidin-2-one |
| SMILES | C=C(C)C12OC(n3ccc(N)nc3=O)C(F)C1(O)C2O |
| InChI | InChI=1S/C12H14FN3O4/c1-5(2)12-9(17)11(12,19)7(13)8(20-12)16-4-3-6(14)15-10(16)18/h3-4,7-9,17,19H,1H2,2H3,(H2,14,15,18) |
| InChIKey | PMQRARQFFODFPN-UHFFFAOYSA-N |
| XLogP | -0.89 |
| TPSA | 110.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.26 |
| LogP ≤ 5 | -0.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|