C11H11F4N3O4 — CID 129151933
4-amino-1-[(1R,3R,4R,5R)-4-fluoro-5,6-dihydroxy-1-(2,2,2-trifluoroethyl)-2-oxabicyclo[3.1.0]hexan-3-yl]pyrimidin-2-one (PubChem CID 129151933) has the molecular formula C11H11F4N3O4 and a molecular weight of 325.22 g/mol. Its IUPAC name is 4-amino-1-[(1R,3R,4R,5R)-4-fluoro-5,6-dihydroxy-1-(2,2,2-trifluoroethyl)-2-oxabicyclo[3.1.0]hexan-3-yl]pyrimidin-2-one.
| Compound Name | 4-amino-1-[(1R,3R,4R,5R)-4-fluoro-5,6-dihydroxy-1-(2,2,2-trifluoroethyl)-2-oxabicyclo[3.1.0]hexan-3-yl]pyrimidin-2-one |
|---|---|
| PubChem CID | 129151933 |
| Molecular Formula | C11H11F4N3O4 |
| Molecular Weight | 325.22 g/mol |
| Exact Mass | 325.07 |
| IUPAC Name | 4-amino-1-[(1R,3R,4R,5R)-4-fluoro-5,6-dihydroxy-1-(2,2,2-trifluoroethyl)-2-oxabicyclo[3.1.0]hexan-3-yl]pyrimidin-2-one |
| SMILES | Nc1ccn([C@@H]2O[C@]3(CC(F)(F)F)C(O)[C@]3(O)[C@H]2F)c(=O)n1 |
| InChI | InChI=1S/C11H11F4N3O4/c12-5-6(18-2-1-4(16)17-8(18)20)22-9(3-10(13,14)15)7(19)11(5,9)21/h1-2,5-7,19,21H,3H2,(H2,16,17,20)/t5-,6+,7?,9+,11+/m0/s1 |
| InChIKey | DIIUHFJXJXOSRP-QMPWVDAASA-N |
| XLogP | -0.51 |
| TPSA | 110.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.22 |
| LogP ≤ 5 | -0.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |