C28H27ClN4O — CID 123181894
4-[1-[3-(5-chloro-2-hept-3-ynyl-1H-imidazol-4-yl)-4-methylbenzoyl]azetidin-3-yl]benzonitrile (PubChem CID 123181894) has the molecular formula C28H27ClN4O and a molecular weight of 471.00 g/mol. Its IUPAC name is 4-[1-[3-(5-chloro-2-hept-3-ynyl-1H-imidazol-4-yl)-4-methylbenzoyl]azetidin-3-yl]benzonitrile.
| Compound Name | 4-[1-[3-(5-chloro-2-hept-3-ynyl-1H-imidazol-4-yl)-4-methylbenzoyl]azetidin-3-yl]benzonitrile |
|---|---|
| PubChem CID | 123181894 |
| Molecular Formula | C28H27ClN4O |
| Molecular Weight | 471.00 g/mol |
| Exact Mass | 470.19 |
| IUPAC Name | 4-[1-[3-(5-chloro-2-hept-3-ynyl-1H-imidazol-4-yl)-4-methylbenzoyl]azetidin-3-yl]benzonitrile |
| SMILES | CCCC#CCCc1nc(-c2cc(C(=O)N3CC(c4ccc(C#N)cc4)C3)ccc2C)c(Cl)[nH]1 |
| InChI | InChI=1S/C28H27ClN4O/c1-3-4-5-6-7-8-25-31-26(27(29)32-25)24-15-22(12-9-19(24)2)28(34)33-17-23(18-33)21-13-10-20(16-30)11-14-21/h9-15,23H,3-4,7-8,17-18H2,1-2H3,(H,31,32) |
| InChIKey | MOXBNJPSXMFXOG-UHFFFAOYSA-N |
| XLogP | 5.89 |
| TPSA | 72.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.00 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|