C19H18N2O — CID 123312174
4-[1-(3,4-dimethylbenzoyl)azetidin-3-yl]benzonitrile (PubChem CID 123312174) has the molecular formula C19H18N2O and a molecular weight of 290.37 g/mol. Its IUPAC name is 4-[1-(3,4-dimethylbenzoyl)azetidin-3-yl]benzonitrile.
| Compound Name | 4-[1-(3,4-dimethylbenzoyl)azetidin-3-yl]benzonitrile |
|---|---|
| PubChem CID | 123312174 |
| Molecular Formula | C19H18N2O |
| Molecular Weight | 290.37 g/mol |
| Exact Mass | 290.14 |
| IUPAC Name | 4-[1-(3,4-dimethylbenzoyl)azetidin-3-yl]benzonitrile |
| SMILES | Cc1ccc(C(=O)N2CC(c3ccc(C#N)cc3)C2)cc1C |
| InChI | InChI=1S/C19H18N2O/c1-13-3-6-17(9-14(13)2)19(22)21-11-18(12-21)16-7-4-15(10-20)5-8-16/h3-9,18H,11-12H2,1-2H3 |
| InChIKey | PLXRRHXQGTZVAT-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 44.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.37 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |