C23H23ClN4O2 — CID 175664113
4-[1-[3-[(E)-1-amino-2-chloro-2-[(E)-2-methoxyethylideneamino]ethenyl]-4-methylbenzoyl]azetidin-3-yl]benzonitrile (PubChem CID 175664113) has the molecular formula C23H23ClN4O2 and a molecular weight of 422.92 g/mol. Its IUPAC name is 4-[1-[3-[(E)-1-amino-2-chloro-2-[(E)-2-methoxyethylideneamino]ethenyl]-4-methylbenzoyl]azetidin-3-yl]benzonitrile.
| Compound Name | 4-[1-[3-[(E)-1-amino-2-chloro-2-[(E)-2-methoxyethylideneamino]ethenyl]-4-methylbenzoyl]azetidin-3-yl]benzonitrile |
|---|---|
| PubChem CID | 175664113 |
| Molecular Formula | C23H23ClN4O2 |
| Molecular Weight | 422.92 g/mol |
| Exact Mass | 422.15 |
| IUPAC Name | 4-[1-[3-[(E)-1-amino-2-chloro-2-[(E)-2-methoxyethylideneamino]ethenyl]-4-methylbenzoyl]azetidin-3-yl]benzonitrile |
| SMILES | COC/C=N/C(Cl)=C(\N)c1cc(C(=O)N2CC(c3ccc(C#N)cc3)C2)ccc1C |
| InChI | InChI=1S/C23H23ClN4O2/c1-15-3-6-18(11-20(15)21(26)22(24)27-9-10-30-2)23(29)28-13-19(14-28)17-7-4-16(12-25)5-8-17/h3-9,11,19H,10,13-14,26H2,1-2H3/b22-21-,27-9+ |
| InChIKey | SWOARTUCZYIGBF-HMPHSINTSA-N |
| XLogP | 3.65 |
| TPSA | 91.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.92 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|