C26H30N4O2 — CID 138717712
4-[1-[5-[(Z)-3-amino-5-methoxy-2-methylpent-2-enimidoyl]-2,4-dimethylbenzoyl]azetidin-3-yl]benzonitrile (PubChem CID 138717712) has the molecular formula C26H30N4O2 and a molecular weight of 430.55 g/mol. Its IUPAC name is 4-[1-[5-[(Z)-3-amino-5-methoxy-2-methylpent-2-enimidoyl]-2,4-dimethylbenzoyl]azetidin-3-yl]benzonitrile.
| Compound Name | 4-[1-[5-[(Z)-3-amino-5-methoxy-2-methylpent-2-enimidoyl]-2,4-dimethylbenzoyl]azetidin-3-yl]benzonitrile |
|---|---|
| PubChem CID | 138717712 |
| Molecular Formula | C26H30N4O2 |
| Molecular Weight | 430.55 g/mol |
| Exact Mass | 430.24 |
| IUPAC Name | 4-[1-[5-[(Z)-3-amino-5-methoxy-2-methylpent-2-enimidoyl]-2,4-dimethylbenzoyl]azetidin-3-yl]benzonitrile |
| SMILES | [H]/N=C(C(\C)=C(/N)CCOC)/c1cc(C(=O)N2CC(c3ccc(C#N)cc3)C2)c(C)cc1C |
| InChI | InChI=1S/C26H30N4O2/c1-16-11-17(2)23(12-22(16)25(29)18(3)24(28)9-10-32-4)26(31)30-14-21(15-30)20-7-5-19(13-27)6-8-20/h5-8,11-12,21,29H,9-10,14-15,28H2,1-4H3/b24-18-,29-25+ |
| InChIKey | VBZZSBFICJQPIB-HYBLWVHFSA-N |
| XLogP | 4.05 |
| TPSA | 103.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.55 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|