C23H24N4O2 — CID 138717786
4-[1-[5-[(E)-1-amino-3-imino-2-methoxyprop-1-enyl]-2,4-dimethylbenzoyl]azetidin-3-yl]benzonitrile (PubChem CID 138717786) has the molecular formula C23H24N4O2 and a molecular weight of 388.47 g/mol. Its IUPAC name is 4-[1-[5-[(E)-1-amino-3-imino-2-methoxyprop-1-enyl]-2,4-dimethylbenzoyl]azetidin-3-yl]benzonitrile.
| Compound Name | 4-[1-[5-[(E)-1-amino-3-imino-2-methoxyprop-1-enyl]-2,4-dimethylbenzoyl]azetidin-3-yl]benzonitrile |
|---|---|
| PubChem CID | 138717786 |
| Molecular Formula | C23H24N4O2 |
| Molecular Weight | 388.47 g/mol |
| Exact Mass | 388.19 |
| IUPAC Name | 4-[1-[5-[(E)-1-amino-3-imino-2-methoxyprop-1-enyl]-2,4-dimethylbenzoyl]azetidin-3-yl]benzonitrile |
| SMILES | [H]/N=C/C(OC)=C(\N)c1cc(C(=O)N2CC(c3ccc(C#N)cc3)C2)c(C)cc1C |
| InChI | InChI=1S/C23H24N4O2/c1-14-8-15(2)20(9-19(14)22(26)21(11-25)29-3)23(28)27-12-18(13-27)17-6-4-16(10-24)5-7-17/h4-9,11,18,25H,12-13,26H2,1-3H3/b22-21+,25-11+ |
| InChIKey | QZPVBLIYLIMPNJ-GZRHFSIRSA-N |
| XLogP | 3.34 |
| TPSA | 103.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.47 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|