C24H29N3O4 — CID 176574164
2-hydroxyethyl (Z)-3-amino-3-[5-[3-(4-methoxyphenyl)azetidine-1-carbonyl]-2-methylphenyl]-2-methylprop-2-enimidate (PubChem CID 176574164) has the molecular formula C24H29N3O4 and a molecular weight of 423.51 g/mol. Its IUPAC name is 2-hydroxyethyl (Z)-3-amino-3-[5-[3-(4-methoxyphenyl)azetidine-1-carbonyl]-2-methylphenyl]-2-methylprop-2-enimidate.
| Compound Name | 2-hydroxyethyl (Z)-3-amino-3-[5-[3-(4-methoxyphenyl)azetidine-1-carbonyl]-2-methylphenyl]-2-methylprop-2-enimidate |
|---|---|
| PubChem CID | 176574164 |
| Molecular Formula | C24H29N3O4 |
| Molecular Weight | 423.51 g/mol |
| Exact Mass | 423.22 |
| IUPAC Name | 2-hydroxyethyl (Z)-3-amino-3-[5-[3-(4-methoxyphenyl)azetidine-1-carbonyl]-2-methylphenyl]-2-methylprop-2-enimidate |
| SMILES | [H]/N=C(OCCO)/C(C)=C(\N)c1cc(C(=O)N2CC(c3ccc(OC)cc3)C2)ccc1C |
| InChI | InChI=1S/C24H29N3O4/c1-15-4-5-18(12-21(15)22(25)16(2)23(26)31-11-10-28)24(29)27-13-19(14-27)17-6-8-20(30-3)9-7-17/h4-9,12,19,26,28H,10-11,13-14,25H2,1-3H3/b22-16-,26-23- |
| InChIKey | SYZIKMPEWLPEBO-ACSFPLRCSA-N |
| XLogP | 2.92 |
| TPSA | 108.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.51 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|