C16H18N4 — CID 123182163
N-methyl-2-(1-methyl-4,5-dihydro-[1,2,4]triazolo[4,3-a]quinolin-7-yl)but-2-en-1-imine (PubChem CID 123182163) has the molecular formula C16H18N4 and a molecular weight of 266.35 g/mol. Its IUPAC name is N-methyl-2-(1-methyl-4,5-dihydro-[1,2,4]triazolo[4,3-a]quinolin-7-yl)but-2-en-1-imine.
| Compound Name | N-methyl-2-(1-methyl-4,5-dihydro-[1,2,4]triazolo[4,3-a]quinolin-7-yl)but-2-en-1-imine |
|---|---|
| PubChem CID | 123182163 |
| Molecular Formula | C16H18N4 |
| Molecular Weight | 266.35 g/mol |
| Exact Mass | 266.15 |
| IUPAC Name | N-methyl-2-(1-methyl-4,5-dihydro-[1,2,4]triazolo[4,3-a]quinolin-7-yl)but-2-en-1-imine |
| SMILES | CC=C(/C=N/C)c1ccc2c(c1)CCc1nnc(C)n1-2 |
| InChI | InChI=1S/C16H18N4/c1-4-12(10-17-3)13-5-7-15-14(9-13)6-8-16-19-18-11(2)20(15)16/h4-5,7,9-10H,6,8H2,1-3H3/b12-4?,17-10+ |
| InChIKey | IIYUTHLBDYWZLR-OCVONDBZSA-N |
| XLogP | 2.78 |
| TPSA | 43.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.35 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|