C23H24 — CID 123183318
1-cyclohexa-1,3-dien-1-yl-4-(3-ethylpenta-1,3-dienyl)naphthalene (PubChem CID 123183318) has the molecular formula C23H24 and a molecular weight of 300.45 g/mol. Its IUPAC name is 1-cyclohexa-1,3-dien-1-yl-4-(3-ethylpenta-1,3-dienyl)naphthalene.
| Compound Name | 1-cyclohexa-1,3-dien-1-yl-4-(3-ethylpenta-1,3-dienyl)naphthalene |
|---|---|
| PubChem CID | 123183318 |
| Molecular Formula | C23H24 |
| Molecular Weight | 300.45 g/mol |
| Exact Mass | 300.19 |
| IUPAC Name | 1-cyclohexa-1,3-dien-1-yl-4-(3-ethylpenta-1,3-dienyl)naphthalene |
| SMILES | CC=C(C=Cc1ccc(C2=CC=CCC2)c2ccccc12)CC |
| InChI | InChI=1S/C23H24/c1-3-18(4-2)14-15-20-16-17-22(19-10-6-5-7-11-19)23-13-9-8-12-21(20)23/h3,5-6,8-10,12-17H,4,7,11H2,1-2H3 |
| InChIKey | KSXYFWGDLIAQFY-UHFFFAOYSA-N |
| XLogP | 6.94 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.45 |
| LogP ≤ 5 | 6.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|