C18H15P — CID 19043656
1-cyclohexa-1,3-dien-1-yl-5H-benzo[b]phosphindole (PubChem CID 19043656) has the molecular formula C18H15P and a molecular weight of 262.29 g/mol. Its IUPAC name is 1-cyclohexa-1,3-dien-1-yl-5H-benzo[b]phosphindole.
| Compound Name | 1-cyclohexa-1,3-dien-1-yl-5H-benzo[b]phosphindole |
|---|---|
| PubChem CID | 19043656 |
| Molecular Formula | C18H15P |
| Molecular Weight | 262.29 g/mol |
| Exact Mass | 262.09 |
| IUPAC Name | 1-cyclohexa-1,3-dien-1-yl-5H-benzo[b]phosphindole |
| SMILES | C1=CCCC(c2cccc3[pH]c4ccccc4c23)=C1 |
| InChI | InChI=1S/C18H15P/c1-2-7-13(8-3-1)14-10-6-12-17-18(14)15-9-4-5-11-16(15)19-17/h1-2,4-7,9-12,19H,3,8H2 |
| InChIKey | KFHHJQDUWQVOJE-UHFFFAOYSA-N |
| XLogP | 5.76 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.29 |
| LogP ≤ 5 | 5.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |