C17H19NO4S — CID 123183728
5-[(2-methoxycarbonylthiophen-3-yl)amino]-2-phenylpentanoic acid (PubChem CID 123183728) has the molecular formula C17H19NO4S and a molecular weight of 333.41 g/mol. Its IUPAC name is 5-[(2-methoxycarbonylthiophen-3-yl)amino]-2-phenylpentanoic acid.
| Compound Name | 5-[(2-methoxycarbonylthiophen-3-yl)amino]-2-phenylpentanoic acid |
|---|---|
| PubChem CID | 123183728 |
| Molecular Formula | C17H19NO4S |
| Molecular Weight | 333.41 g/mol |
| Exact Mass | 333.10 |
| IUPAC Name | 5-[(2-methoxycarbonylthiophen-3-yl)amino]-2-phenylpentanoic acid |
| SMILES | COC(=O)c1sccc1NCCCC(C(=O)O)c1ccccc1 |
| InChI | InChI=1S/C17H19NO4S/c1-22-17(21)15-14(9-11-23-15)18-10-5-8-13(16(19)20)12-6-3-2-4-7-12/h2-4,6-7,9,11,13,18H,5,8,10H2,1H3,(H,19,20) |
| InChIKey | BMKXCEJLRXMTAQ-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.41 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|