C11H14N2 — CID 123184632
3,6-dimethyl-3,4-dihydropyrido[1,2-b]diazepine (PubChem CID 123184632) has the molecular formula C11H14N2 and a molecular weight of 174.25 g/mol. Its IUPAC name is 3,6-dimethyl-3,4-dihydropyrido[1,2-b]diazepine.
| Compound Name | 3,6-dimethyl-3,4-dihydropyrido[1,2-b]diazepine |
|---|---|
| PubChem CID | 123184632 |
| Molecular Formula | C11H14N2 |
| Molecular Weight | 174.25 g/mol |
| Exact Mass | 174.12 |
| IUPAC Name | 3,6-dimethyl-3,4-dihydropyrido[1,2-b]diazepine |
| SMILES | CC1=CC=CN2N=CC(C)CC=C12 |
| InChI | InChI=1S/C11H14N2/c1-9-5-6-11-10(2)4-3-7-13(11)12-8-9/h3-4,6-9H,5H2,1-2H3 |
| InChIKey | XQHUQVAEOYMBJY-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 174.25 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |