About 3-(cyclopropylmethyl)-1-ethyl-1,4-dimethylcyclohexane
3-(cyclopropylmethyl)-1-ethyl-1,4-dimethylcyclohexane (PubChem CID 123184882) has the molecular formula C14H26
and a molecular weight of 194.36 g/mol. Its IUPAC name is 3-(cyclopropylmethyl)-1-ethyl-1,4-dimethylcyclohexane.
Molecular Properties
| Compound Name | 3-(cyclopropylmethyl)-1-ethyl-1,4-dimethylcyclohexane |
| PubChem CID | 123184882 |
| Molecular Formula | C14H26 |
| Molecular Weight | 194.36 g/mol |
| Exact Mass | 194.20 |
| IUPAC Name | 3-(cyclopropylmethyl)-1-ethyl-1,4-dimethylcyclohexane |
| SMILES | CCC1(C)CCC(C)C(CC2CC2)C1 |
| InChI | InChI=1S/C14H26/c1-4-14(3)8-7-11(2)13(10-14)9-12-5-6-12/h11-13H,4-10H2,1-3H3 |
| InChIKey | YOQJJZVXGCQEQG-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 194.36 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 3-(cyclopropylmethyl)-1-ethyl-1,4-dimethylcyclohexane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(cyclopropylmethyl)-1-ethyl-1,4-dimethylcyclohexane?
The IUPAC name of 3-(cyclopropylmethyl)-1-ethyl-1,4-dimethylcyclohexane (CID 123184882) is 3-(cyclopropylmethyl)-1-ethyl-1,4-dimethylcyclohexane.
What is the SMILES notation for 3-(cyclopropylmethyl)-1-ethyl-1,4-dimethylcyclohexane?
The canonical SMILES for 3-(cyclopropylmethyl)-1-ethyl-1,4-dimethylcyclohexane is CCC1(C)CCC(C)C(CC2CC2)C1.
What is the InChIKey of 3-(cyclopropylmethyl)-1-ethyl-1,4-dimethylcyclohexane?
The InChIKey is YOQJJZVXGCQEQG-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H26/c1-4-14(3)8-7-11(2)13(10-14)9-12-5-6-12/h11-13H,4-10H2,1-3H3.
What are the key properties of 3-(cyclopropylmethyl)-1-ethyl-1,4-dimethylcyclohexane?
3-(cyclopropylmethyl)-1-ethyl-1,4-dimethylcyclohexane has a molecular weight of 194.36 g/mol, XLogP of 4.64, 3 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(cyclopropylmethyl)-1-ethyl-1,4-dimethylcyclohexane is sourced from PubChem (CID 123184882), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).