C20H14Cl2N2O5 — CID 123184888
3,5-dichloro-4-[2-(4-methoxy-8-nitrodibenzofuran-1-yl)ethyl]-1-oxidopyridin-1-ium (PubChem CID 123184888) has the molecular formula C20H14Cl2N2O5 and a molecular weight of 433.25 g/mol. Its IUPAC name is 3,5-dichloro-4-[2-(4-methoxy-8-nitrodibenzofuran-1-yl)ethyl]-1-oxidopyridin-1-ium.
| Compound Name | 3,5-dichloro-4-[2-(4-methoxy-8-nitrodibenzofuran-1-yl)ethyl]-1-oxidopyridin-1-ium |
|---|---|
| PubChem CID | 123184888 |
| Molecular Formula | C20H14Cl2N2O5 |
| Molecular Weight | 433.25 g/mol |
| Exact Mass | 432.03 |
| IUPAC Name | 3,5-dichloro-4-[2-(4-methoxy-8-nitrodibenzofuran-1-yl)ethyl]-1-oxidopyridin-1-ium |
| SMILES | COc1ccc(CCc2c(Cl)c[n+]([O-])cc2Cl)c2c1oc1ccc([N+](=O)[O-])cc12 |
| InChI | InChI=1S/C20H14Cl2N2O5/c1-28-18-6-3-11(2-5-13-15(21)9-23(25)10-16(13)22)19-14-8-12(24(26)27)4-7-17(14)29-20(18)19/h3-4,6-10H,2,5H2,1H3 |
| InChIKey | JBOHJSCHKLKHNT-UHFFFAOYSA-N |
| XLogP | 5.23 |
| TPSA | 92.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.25 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|